C22H23ClF2N2O2 — CID 137447201
tert-butyl (3S)-4-(3-chloro-6-fluorocarbazol-9-yl)-3-fluoropiperidine-1-carboxylate (PubChem CID 137447201) has the molecular formula C22H23ClF2N2O2 and a molecular weight of 420.89 g/mol. Its IUPAC name is tert-butyl (3S)-4-(3-chloro-6-fluorocarbazol-9-yl)-3-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-(3-chloro-6-fluorocarbazol-9-yl)-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 137447201 |
| Molecular Formula | C22H23ClF2N2O2 |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | tert-butyl (3S)-4-(3-chloro-6-fluorocarbazol-9-yl)-3-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2c3ccc(F)cc3c3cc(Cl)ccc32)[C@@H](F)C1 |
| InChI | InChI=1S/C22H23ClF2N2O2/c1-22(2,3)29-21(28)26-9-8-20(17(25)12-26)27-18-6-4-13(23)10-15(18)16-11-14(24)5-7-19(16)27/h4-7,10-11,17,20H,8-9,12H2,1-3H3/t17-,20?/m0/s1 |
| InChIKey | KCFOXXBZLJGYCP-DIMJTDRSSA-N |
| XLogP | 6.11 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |