C22H24ClFN2O3 — CID 144664138
tert-butyl 4-(3-chloro-6-hydroxycarbazol-9-yl)-3-fluoropiperidine-1-carboxylate (PubChem CID 144664138) has the molecular formula C22H24ClFN2O3 and a molecular weight of 418.90 g/mol. Its IUPAC name is tert-butyl 4-(3-chloro-6-hydroxycarbazol-9-yl)-3-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-chloro-6-hydroxycarbazol-9-yl)-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 144664138 |
| Molecular Formula | C22H24ClFN2O3 |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | tert-butyl 4-(3-chloro-6-hydroxycarbazol-9-yl)-3-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2c3ccc(O)cc3c3cc(Cl)ccc32)C(F)C1 |
| InChI | InChI=1S/C22H24ClFN2O3/c1-22(2,3)29-21(28)25-9-8-20(17(24)12-25)26-18-6-4-13(23)10-15(18)16-11-14(27)5-7-19(16)26/h4-7,10-11,17,20,27H,8-9,12H2,1-3H3 |
| InChIKey | DYDXDKCXNOZUFD-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |