C23H26Cl2N2O3 — CID 129133337
tert-butyl (3R)-4-(3,6-dichlorocarbazol-9-yl)-3-hydroxyazepane-1-carboxylate (PubChem CID 129133337) has the molecular formula C23H26Cl2N2O3 and a molecular weight of 449.38 g/mol. Its IUPAC name is tert-butyl (3R)-4-(3,6-dichlorocarbazol-9-yl)-3-hydroxyazepane-1-carboxylate.
| Compound Name | tert-butyl (3R)-4-(3,6-dichlorocarbazol-9-yl)-3-hydroxyazepane-1-carboxylate |
|---|---|
| PubChem CID | 129133337 |
| Molecular Formula | C23H26Cl2N2O3 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | tert-butyl (3R)-4-(3,6-dichlorocarbazol-9-yl)-3-hydroxyazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(n2c3ccc(Cl)cc3c3cc(Cl)ccc32)[C@H](O)C1 |
| InChI | InChI=1S/C23H26Cl2N2O3/c1-23(2,3)30-22(29)26-10-4-5-20(21(28)13-26)27-18-8-6-14(24)11-16(18)17-12-15(25)7-9-19(17)27/h6-9,11-12,20-21,28H,4-5,10,13H2,1-3H3/t20?,21-/m1/s1 |
| InChIKey | MLYMDQIYBGGXAQ-BPGUCPLFSA-N |
| XLogP | 6.03 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |