C17H19ClN2O4 — CID 66759082
tert-butyl 3-(5-chloro-1,3-dioxoisoindol-2-yl)pyrrolidine-1-carboxylate (PubChem CID 66759082) has the molecular formula C17H19ClN2O4 and a molecular weight of 350.80 g/mol. Its IUPAC name is tert-butyl 3-(5-chloro-1,3-dioxoisoindol-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(5-chloro-1,3-dioxoisoindol-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66759082 |
| Molecular Formula | C17H19ClN2O4 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | tert-butyl 3-(5-chloro-1,3-dioxoisoindol-2-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2C(=O)c3ccc(Cl)cc3C2=O)C1 |
| InChI | InChI=1S/C17H19ClN2O4/c1-17(2,3)24-16(23)19-7-6-11(9-19)20-14(21)12-5-4-10(18)8-13(12)15(20)22/h4-5,8,11H,6-7,9H2,1-3H3 |
| InChIKey | CFXCSQSJRWHTAS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|