C18H22N2O5 — CID 168827073
tert-butyl (3R,5R)-3-(1,3-dioxoisoindol-2-yl)-5-hydroxypiperidine-1-carboxylate (PubChem CID 168827073) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is tert-butyl (3R,5R)-3-(1,3-dioxoisoindol-2-yl)-5-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,5R)-3-(1,3-dioxoisoindol-2-yl)-5-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 168827073 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | tert-butyl (3R,5R)-3-(1,3-dioxoisoindol-2-yl)-5-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O)C[C@@H](N2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C18H22N2O5/c1-18(2,3)25-17(24)19-9-11(8-12(21)10-19)20-15(22)13-6-4-5-7-14(13)16(20)23/h4-7,11-12,21H,8-10H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | MLPABOLHSHJRKI-VXGBXAGGSA-N |
| XLogP | 1.65 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|