C24H30N2O4 — CID 143006218
tert-butyl carbamate;2-(2,3-dihydro-1H-inden-2-yl)isoindole-1,3-dione;ethane (PubChem CID 143006218) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is tert-butyl carbamate;2-(2,3-dihydro-1H-inden-2-yl)isoindole-1,3-dione;ethane.
| Compound Name | tert-butyl carbamate;2-(2,3-dihydro-1H-inden-2-yl)isoindole-1,3-dione;ethane |
|---|---|
| PubChem CID | 143006218 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | tert-butyl carbamate;2-(2,3-dihydro-1H-inden-2-yl)isoindole-1,3-dione;ethane |
| SMILES | CC.CC(C)(C)OC(N)=O.O=C1c2ccccc2C(=O)N1C1Cc2ccccc2C1 |
| InChI | InChI=1S/C17H13NO2.C5H11NO2.C2H6/c19-16-14-7-3-4-8-15(14)17(20)18(16)13-9-11-5-1-2-6-12(11)10-13;1-5(2,3)8-4(6)7;1-2/h1-8,13H,9-10H2;1-3H3,(H2,6,7);1-2H3 |
| InChIKey | QEQIKVHOOGJFTF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|