C20H34N2O2 — CID 90979720
ethane;2-(1-methylpiperidin-4-yl)isoindole-1,3-dione (PubChem CID 90979720) has the molecular formula C20H34N2O2 and a molecular weight of 334.50 g/mol. Its IUPAC name is ethane;2-(1-methylpiperidin-4-yl)isoindole-1,3-dione.
| Compound Name | ethane;2-(1-methylpiperidin-4-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 90979720 |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | ethane;2-(1-methylpiperidin-4-yl)isoindole-1,3-dione |
| SMILES | CC.CC.CC.CN1CCC(N2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C14H16N2O2.3C2H6/c1-15-8-6-10(7-9-15)16-13(17)11-4-2-3-5-12(11)14(16)18;3*1-2/h2-5,10H,6-9H2,1H3;3*1-2H3 |
| InChIKey | ZUMVFXDKGJADLS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|