About tert-butyl (3S,4S)-3-(6-aminopyridazin-3-yl)oxy-4-fluoropiperidine-1-carboxylate
tert-butyl (3S,4S)-3-(6-aminopyridazin-3-yl)oxy-4-fluoropiperidine-1-carboxylate (PubChem CID 140876664) has the molecular formula C14H21FN4O3
and a molecular weight of 312.35 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-(6-aminopyridazin-3-yl)oxy-4-fluoropiperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (3S,4S)-3-(6-aminopyridazin-3-yl)oxy-4-fluoropiperidine-1-carboxylate |
| PubChem CID | 140876664 |
| Molecular Formula | C14H21FN4O3 |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | tert-butyl (3S,4S)-3-(6-aminopyridazin-3-yl)oxy-4-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](F)[C@@H](Oc2ccc(N)nn2)C1 |
| InChI | InChI=1S/C14H21FN4O3/c1-14(2,3)22-13(20)19-7-6-9(15)10(8-19)21-12-5-4-11(16)17-18-12/h4-5,9-10H,6-8H2,1-3H3,(H2,16,17)/t9-,10-/m0/s1 |
| InChIKey | DBBMQXUNQNTAMG-UWVGGRQHSA-N |
| XLogP | 1.79 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl (3S,4S)-3-(6-aminopyridazin-3-yl)oxy-4-fluoropiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3S,4S)-3-(6-aminopyridazin-3-yl)oxy-4-fluoropiperidine-1-carboxylate?
The IUPAC name of tert-butyl (3S,4S)-3-(6-aminopyridazin-3-yl)oxy-4-fluoropiperidine-1-carboxylate (CID 140876664) is tert-butyl (3S,4S)-3-(6-aminopyridazin-3-yl)oxy-4-fluoropiperidine-1-carboxylate.
What is the SMILES notation for tert-butyl (3S,4S)-3-(6-aminopyridazin-3-yl)oxy-4-fluoropiperidine-1-carboxylate?
The canonical SMILES for tert-butyl (3S,4S)-3-(6-aminopyridazin-3-yl)oxy-4-fluoropiperidine-1-carboxylate is CC(C)(C)OC(=O)N1CC[C@H](F)[C@@H](Oc2ccc(N)nn2)C1.
What is the InChIKey of tert-butyl (3S,4S)-3-(6-aminopyridazin-3-yl)oxy-4-fluoropiperidine-1-carboxylate?
The InChIKey is DBBMQXUNQNTAMG-UWVGGRQHSA-N. The full InChI is InChI=1S/C14H21FN4O3/c1-14(2,3)22-13(20)19-7-6-9(15)10(8-19)21-12-5-4-11(16)17-18-12/h4-5,9-10H,6-8H2,1-3H3,(H2,16,17)/t9-,10-/m0/s1.
What are the key properties of tert-butyl (3S,4S)-3-(6-aminopyridazin-3-yl)oxy-4-fluoropiperidine-1-carboxylate?
tert-butyl (3S,4S)-3-(6-aminopyridazin-3-yl)oxy-4-fluoropiperidine-1-carboxylate has a molecular weight of 312.35 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3S,4S)-3-(6-aminopyridazin-3-yl)oxy-4-fluoropiperidine-1-carboxylate is sourced from PubChem (CID 140876664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).