C28H30FNO2 — CID 86604460
tert-butyl 4-(4-fluorophenyl)-3-[(E)-2-naphthalen-2-ylethenyl]piperidine-1-carboxylate (PubChem CID 86604460) has the molecular formula C28H30FNO2 and a molecular weight of 431.55 g/mol. Its IUPAC name is tert-butyl 4-(4-fluorophenyl)-3-[(E)-2-naphthalen-2-ylethenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-fluorophenyl)-3-[(E)-2-naphthalen-2-ylethenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86604460 |
| Molecular Formula | C28H30FNO2 |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | tert-butyl 4-(4-fluorophenyl)-3-[(E)-2-naphthalen-2-ylethenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(F)cc2)C(/C=C/c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C28H30FNO2/c1-28(2,3)32-27(31)30-17-16-26(22-12-14-25(29)15-13-22)24(19-30)11-9-20-8-10-21-6-4-5-7-23(21)18-20/h4-15,18,24,26H,16-17,19H2,1-3H3/b11-9+ |
| InChIKey | VGIHABJOMLNQSL-PKNBQFBNSA-N |
| XLogP | 7.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |