C16H21F2NO3 — CID 54596029
tert-butyl 4-(3,5-difluorophenyl)-3-hydroxypiperidine-1-carboxylate (PubChem CID 54596029) has the molecular formula C16H21F2NO3 and a molecular weight of 313.34 g/mol. Its IUPAC name is tert-butyl 4-(3,5-difluorophenyl)-3-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3,5-difluorophenyl)-3-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 54596029 |
| Molecular Formula | C16H21F2NO3 |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | tert-butyl 4-(3,5-difluorophenyl)-3-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(F)cc(F)c2)C(O)C1 |
| InChI | InChI=1S/C16H21F2NO3/c1-16(2,3)22-15(21)19-5-4-13(14(20)9-19)10-6-11(17)8-12(18)7-10/h6-8,13-14,20H,4-5,9H2,1-3H3 |
| InChIKey | CYIOEHSDBQCTNI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |