C15H23N3O3S — CID 90761230
tert-butyl 3-hydroxy-4-(2-methylsulfanylpyrimidin-5-yl)piperidine-1-carboxylate (PubChem CID 90761230) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-4-(2-methylsulfanylpyrimidin-5-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-hydroxy-4-(2-methylsulfanylpyrimidin-5-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90761230 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | tert-butyl 3-hydroxy-4-(2-methylsulfanylpyrimidin-5-yl)piperidine-1-carboxylate |
| SMILES | CSc1ncc(C2CCN(C(=O)OC(C)(C)C)CC2O)cn1 |
| InChI | InChI=1S/C15H23N3O3S/c1-15(2,3)21-14(20)18-6-5-11(12(19)9-18)10-7-16-13(22-4)17-8-10/h7-8,11-12,19H,5-6,9H2,1-4H3 |
| InChIKey | QDBWVAHQVMPIJP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |