About tert-butyl (3S,4R)-3-[2-(3-cyanophenyl)ethyl]-4-(4-methoxyphenyl)piperidine-1-carboxylate
tert-butyl (3S,4R)-3-[2-(3-cyanophenyl)ethyl]-4-(4-methoxyphenyl)piperidine-1-carboxylate (PubChem CID 130263932) has the molecular formula C26H32N2O3
and a molecular weight of 420.55 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-[2-(3-cyanophenyl)ethyl]-4-(4-methoxyphenyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (3S,4R)-3-[2-(3-cyanophenyl)ethyl]-4-(4-methoxyphenyl)piperidine-1-carboxylate |
| PubChem CID | 130263932 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | tert-butyl (3S,4R)-3-[2-(3-cyanophenyl)ethyl]-4-(4-methoxyphenyl)piperidine-1-carboxylate |
| SMILES | COc1ccc([C@@H]2CCN(C(=O)OC(C)(C)C)C[C@H]2CCc2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C26H32N2O3/c1-26(2,3)31-25(29)28-15-14-24(21-10-12-23(30-4)13-11-21)22(18-28)9-8-19-6-5-7-20(16-19)17-27/h5-7,10-13,16,22,24H,8-9,14-15,18H2,1-4H3/t22-,24+/m1/s1 |
| InChIKey | DDKOVJJPSPUGGN-VWNXMTODSA-N |
| XLogP | 5.54 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (3S,4R)-3-[2-(3-cyanophenyl)ethyl]-4-(4-methoxyphenyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3S,4R)-3-[2-(3-cyanophenyl)ethyl]-4-(4-methoxyphenyl)piperidine-1-carboxylate?
The IUPAC name of tert-butyl (3S,4R)-3-[2-(3-cyanophenyl)ethyl]-4-(4-methoxyphenyl)piperidine-1-carboxylate (CID 130263932) is tert-butyl (3S,4R)-3-[2-(3-cyanophenyl)ethyl]-4-(4-methoxyphenyl)piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl (3S,4R)-3-[2-(3-cyanophenyl)ethyl]-4-(4-methoxyphenyl)piperidine-1-carboxylate?
The canonical SMILES for tert-butyl (3S,4R)-3-[2-(3-cyanophenyl)ethyl]-4-(4-methoxyphenyl)piperidine-1-carboxylate is COc1ccc([C@@H]2CCN(C(=O)OC(C)(C)C)C[C@H]2CCc2cccc(C#N)c2)cc1.
What is the InChIKey of tert-butyl (3S,4R)-3-[2-(3-cyanophenyl)ethyl]-4-(4-methoxyphenyl)piperidine-1-carboxylate?
The InChIKey is DDKOVJJPSPUGGN-VWNXMTODSA-N. The full InChI is InChI=1S/C26H32N2O3/c1-26(2,3)31-25(29)28-15-14-24(21-10-12-23(30-4)13-11-21)22(18-28)9-8-19-6-5-7-20(16-19)17-27/h5-7,10-13,16,22,24H,8-9,14-15,18H2,1-4H3/t22-,24+/m1/s1.
What are the key properties of tert-butyl (3S,4R)-3-[2-(3-cyanophenyl)ethyl]-4-(4-methoxyphenyl)piperidine-1-carboxylate?
tert-butyl (3S,4R)-3-[2-(3-cyanophenyl)ethyl]-4-(4-methoxyphenyl)piperidine-1-carboxylate has a molecular weight of 420.55 g/mol, XLogP of 5.54, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3S,4R)-3-[2-(3-cyanophenyl)ethyl]-4-(4-methoxyphenyl)piperidine-1-carboxylate is sourced from PubChem (CID 130263932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).