C24H29N3O3S — CID 56639743
tert-butyl 4-[[1-[(3-cyanophenyl)methyl]-2-sulfanylidene-4-pyridinyl]oxymethyl]piperidine-1-carboxylate (PubChem CID 56639743) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is tert-butyl 4-[[1-[(3-cyanophenyl)methyl]-2-sulfanylidene-4-pyridinyl]oxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[1-[(3-cyanophenyl)methyl]-2-sulfanylidene-4-pyridinyl]oxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 56639743 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | tert-butyl 4-[[1-[(3-cyanophenyl)methyl]-2-sulfanylidene-4-pyridinyl]oxymethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(COc2ccn(Cc3cccc(C#N)c3)c(=S)c2)CC1 |
| InChI | InChI=1S/C24H29N3O3S/c1-24(2,3)30-23(28)26-10-7-18(8-11-26)17-29-21-9-12-27(22(31)14-21)16-20-6-4-5-19(13-20)15-25/h4-6,9,12-14,18H,7-8,10-11,16-17H2,1-3H3 |
| InChIKey | IEXCDIHLXLEOGD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 67.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|