C19H25NO7 — CID 134579774
4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methoxy]phthalic acid (PubChem CID 134579774) has the molecular formula C19H25NO7 and a molecular weight of 379.41 g/mol. Its IUPAC name is 4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methoxy]phthalic acid.
| Compound Name | 4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methoxy]phthalic acid |
|---|---|
| PubChem CID | 134579774 |
| Molecular Formula | C19H25NO7 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]methoxy]phthalic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC(COc2ccc(C(=O)O)c(C(=O)O)c2)CC1 |
| InChI | InChI=1S/C19H25NO7/c1-19(2,3)27-18(25)20-8-6-12(7-9-20)11-26-13-4-5-14(16(21)22)15(10-13)17(23)24/h4-5,10,12H,6-9,11H2,1-3H3,(H,21,22)(H,23,24) |
| InChIKey | PZMZLESIFNHYCY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |