C17H22N2O4 — CID 129278341
tert-butyl (3S,4S)-4-(3-cyanophenoxy)-3-hydroxypiperidine-1-carboxylate (PubChem CID 129278341) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is tert-butyl (3S,4S)-4-(3-cyanophenoxy)-3-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-4-(3-cyanophenoxy)-3-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 129278341 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | tert-butyl (3S,4S)-4-(3-cyanophenoxy)-3-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](Oc2cccc(C#N)c2)[C@@H](O)C1 |
| InChI | InChI=1S/C17H22N2O4/c1-17(2,3)23-16(21)19-8-7-15(14(20)11-19)22-13-6-4-5-12(9-13)10-18/h4-6,9,14-15,20H,7-8,11H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | XHKKYLIOVZQKFV-GJZGRUSLSA-N |
| XLogP | 2.31 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |