C24H33NO6 — CID 139830630
tert-butyl 3-hydroxy-4-(4-phenoxyphenoxy)piperidine-1-carboxylate;ethanol (PubChem CID 139830630) has the molecular formula C24H33NO6 and a molecular weight of 431.53 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-4-(4-phenoxyphenoxy)piperidine-1-carboxylate;ethanol.
| Compound Name | tert-butyl 3-hydroxy-4-(4-phenoxyphenoxy)piperidine-1-carboxylate;ethanol |
|---|---|
| PubChem CID | 139830630 |
| Molecular Formula | C24H33NO6 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | tert-butyl 3-hydroxy-4-(4-phenoxyphenoxy)piperidine-1-carboxylate;ethanol |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc(Oc3ccccc3)cc2)C(O)C1.CCO |
| InChI | InChI=1S/C22H27NO5.C2H6O/c1-22(2,3)28-21(25)23-14-13-20(19(24)15-23)27-18-11-9-17(10-12-18)26-16-7-5-4-6-8-16;1-2-3/h4-12,19-20,24H,13-15H2,1-3H3;3H,2H2,1H3 |
| InChIKey | DVMSXORHVJXDCX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |