C22H24N2O3 — CID 126650196
3-[2-(3-cyanophenyl)ethyl]-4-(4-methoxyphenyl)piperidine-1-carboxylic acid (PubChem CID 126650196) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 3-[2-(3-cyanophenyl)ethyl]-4-(4-methoxyphenyl)piperidine-1-carboxylic acid.
| Compound Name | 3-[2-(3-cyanophenyl)ethyl]-4-(4-methoxyphenyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 126650196 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 3-[2-(3-cyanophenyl)ethyl]-4-(4-methoxyphenyl)piperidine-1-carboxylic acid |
| SMILES | COc1ccc(C2CCN(C(=O)O)CC2CCc2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C22H24N2O3/c1-27-20-9-7-18(8-10-20)21-11-12-24(22(25)26)15-19(21)6-5-16-3-2-4-17(13-16)14-23/h2-4,7-10,13,19,21H,5-6,11-12,15H2,1H3,(H,25,26) |
| InChIKey | MIBHOPPIMXNYPA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |