C16H16S — CID 56653927
(5aS,11bR)-4,5,5a,6,7,11b-hexahydronaphtho[2,1-g][1]benzothiole (PubChem CID 56653927) has the molecular formula C16H16S and a molecular weight of 240.37 g/mol. Its IUPAC name is (5aS,11bR)-4,5,5a,6,7,11b-hexahydronaphtho[2,1-g][1]benzothiole.
| Compound Name | (5aS,11bR)-4,5,5a,6,7,11b-hexahydronaphtho[2,1-g][1]benzothiole |
|---|---|
| PubChem CID | 56653927 |
| Molecular Formula | C16H16S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (5aS,11bR)-4,5,5a,6,7,11b-hexahydronaphtho[2,1-g][1]benzothiole |
| SMILES | c1ccc2c(c1)CC[C@H]1CCc3ccsc3[C@@H]21 |
| InChI | InChI=1S/C16H16S/c1-2-4-14-11(3-1)5-6-12-7-8-13-9-10-17-16(13)15(12)14/h1-4,9-10,12,15H,5-8H2/t12-,15+/m0/s1 |
| InChIKey | CHDMRCQBRNORBK-SWLSCSKDSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |