C13H14 — CID 173290143
3a,4,5,9b-tetrahydro-3H-cyclopenta[a]naphthalene (PubChem CID 173290143) has the molecular formula C13H14 and a molecular weight of 170.25 g/mol. Its IUPAC name is 3a,4,5,9b-tetrahydro-3H-cyclopenta[a]naphthalene.
| Compound Name | 3a,4,5,9b-tetrahydro-3H-cyclopenta[a]naphthalene |
|---|---|
| PubChem CID | 173290143 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 3a,4,5,9b-tetrahydro-3H-cyclopenta[a]naphthalene |
| SMILES | C1=CC2c3ccccc3CCC2C1 |
| InChI | InChI=1S/C13H14/c1-2-6-12-10(4-1)8-9-11-5-3-7-13(11)12/h1-4,6-7,11,13H,5,8-9H2 |
| InChIKey | BEGBKURVCLWAEM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|