C14H15N — CID 15231978
8-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),3,11(15),12-tetraene (PubChem CID 15231978) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is 8-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),3,11(15),12-tetraene.
| Compound Name | 8-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),3,11(15),12-tetraene |
|---|---|
| PubChem CID | 15231978 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 8-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),3,11(15),12-tetraene |
| SMILES | C1=CC2c3cccc4c3N(CC4)CC2C1 |
| InChI | InChI=1S/C14H15N/c1-3-10-7-8-15-9-11-4-2-5-12(11)13(6-1)14(10)15/h1-3,5-6,11-12H,4,7-9H2 |
| InChIKey | GBONYWSZXIMTPT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|