C29H38N4 — CID 162018965
10,14-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1,3,5(17)-triene;1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-triene (PubChem CID 162018965) has the molecular formula C29H38N4 and a molecular weight of 442.65 g/mol. Its IUPAC name is 10,14-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1,3,5(17)-triene;1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-triene.
| Compound Name | 10,14-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1,3,5(17)-triene;1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-triene |
|---|---|
| PubChem CID | 162018965 |
| Molecular Formula | C29H38N4 |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | 10,14-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1,3,5(17)-triene;1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-triene |
| SMILES | c1cc2c3c(c1)C1CNCC1CN3CCC2.c1cc2c3c(c1)C1CNCC1CN3CCCC2 |
| InChI | InChI=1S/C15H20N2.C14H18N2/c1-2-7-17-10-12-8-16-9-14(12)13-6-3-5-11(4-1)15(13)17;1-3-10-4-2-6-16-9-11-7-15-8-13(11)12(5-1)14(10)16/h3,5-6,12,14,16H,1-2,4,7-10H2;1,3,5,11,13,15H,2,4,6-9H2 |
| InChIKey | YUMNRNBQEVACDK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |