C14H17ClN2O — CID 131724527
(10R,14S)-1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-trien-15-one;hydrochloride (PubChem CID 131724527) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is (10R,14S)-1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-trien-15-one;hydrochloride.
| Compound Name | (10R,14S)-1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-trien-15-one;hydrochloride |
|---|---|
| PubChem CID | 131724527 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (10R,14S)-1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-trien-15-one;hydrochloride |
| SMILES | Cl.O=C1[C@@H]2CNC[C@H]2c2cccc3c2N1CCC3 |
| InChI | InChI=1S/C14H16N2O.ClH/c17-14-12-8-15-7-11(12)10-5-1-3-9-4-2-6-16(14)13(9)10;/h1,3,5,11-12,15H,2,4,6-8H2;1H/t11-,12+;/m0./s1 |
| InChIKey | OKPRFMQKDQUFGR-ZVWHLABXSA-N |
| XLogP | 1.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |