C21H22N2O — CID 68525379
(10S,14R)-12-benzyl-1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-trien-15-one (PubChem CID 68525379) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is (10S,14R)-12-benzyl-1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-trien-15-one.
| Compound Name | (10S,14R)-12-benzyl-1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-trien-15-one |
|---|---|
| PubChem CID | 68525379 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (10S,14R)-12-benzyl-1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-trien-15-one |
| SMILES | O=C1[C@H]2CN(Cc3ccccc3)C[C@@H]2c2cccc3c2N1CCC3 |
| InChI | InChI=1S/C21H22N2O/c24-21-19-14-22(12-15-6-2-1-3-7-15)13-18(19)17-10-4-8-16-9-5-11-23(21)20(16)17/h1-4,6-8,10,18-19H,5,9,11-14H2/t18-,19+/m1/s1 |
| InChIKey | KTJRHGOOVIRRRJ-MOPGFXCFSA-N |
| XLogP | 3.19 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |