C23H23NO2 — CID 70345589
2-[(3S,4R)-1-benzyl-4-(2-hydroxyphenyl)pyrrolidin-3-yl]phenol (PubChem CID 70345589) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-[(3S,4R)-1-benzyl-4-(2-hydroxyphenyl)pyrrolidin-3-yl]phenol.
| Compound Name | 2-[(3S,4R)-1-benzyl-4-(2-hydroxyphenyl)pyrrolidin-3-yl]phenol |
|---|---|
| PubChem CID | 70345589 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-[(3S,4R)-1-benzyl-4-(2-hydroxyphenyl)pyrrolidin-3-yl]phenol |
| SMILES | Oc1ccccc1[C@H]1CN(Cc2ccccc2)C[C@H]1c1ccccc1O |
| InChI | InChI=1S/C23H23NO2/c25-22-12-6-4-10-18(22)20-15-24(14-17-8-2-1-3-9-17)16-21(20)19-11-5-7-13-23(19)26/h1-13,20-21,25-26H,14-16H2/t20-,21+ |
| InChIKey | GGCMQYPUYPNBLK-OYRHEFFESA-N |
| XLogP | 4.48 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |