C23H33NO — CID 159906270
ethane;methane;8-methyl-10-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2,4,6,14(18),15-hexaen-9-one (PubChem CID 159906270) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is ethane;methane;8-methyl-10-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2,4,6,14(18),15-hexaen-9-one.
| Compound Name | ethane;methane;8-methyl-10-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2,4,6,14(18),15-hexaen-9-one |
|---|---|
| PubChem CID | 159906270 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | ethane;methane;8-methyl-10-azatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),2,4,6,14(18),15-hexaen-9-one |
| SMILES | C.CC.CC.CC1C(=O)N2CCCc3cccc(c32)-c2ccccc21 |
| InChI | InChI=1S/C18H17NO.2C2H6.CH4/c1-12-14-8-2-3-9-15(14)16-10-4-6-13-7-5-11-19(17(13)16)18(12)20;2*1-2;/h2-4,6,8-10,12H,5,7,11H2,1H3;2*1-2H3;1H4 |
| InChIKey | NWPMYBXADWGIAA-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |