C15H13NO4 — CID 54677694
6-hydroxy-3-oxa-9-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),5,13(17),14-tetraene-4,8-dione (PubChem CID 54677694) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is 6-hydroxy-3-oxa-9-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),5,13(17),14-tetraene-4,8-dione.
| Compound Name | 6-hydroxy-3-oxa-9-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),5,13(17),14-tetraene-4,8-dione |
|---|---|
| PubChem CID | 54677694 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 6-hydroxy-3-oxa-9-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),5,13(17),14-tetraene-4,8-dione |
| SMILES | O=C1C=C(O)C2C(=O)N3CCCc4cccc(c43)C2O1 |
| InChI | InChI=1S/C15H13NO4/c17-10-7-11(18)20-14-9-5-1-3-8-4-2-6-16(13(8)9)15(19)12(10)14/h1,3,5,7,12,14,17H,2,4,6H2 |
| InChIKey | DGHAMFNMHZBIAB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |