C20H26N2O3 — CID 131737695
tert-butyl (2R,7S)-8-oxo-4,9-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),13(17),14-triene-4-carboxylate (PubChem CID 131737695) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is tert-butyl (2R,7S)-8-oxo-4,9-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),13(17),14-triene-4-carboxylate.
| Compound Name | tert-butyl (2R,7S)-8-oxo-4,9-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),13(17),14-triene-4-carboxylate |
|---|---|
| PubChem CID | 131737695 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | tert-butyl (2R,7S)-8-oxo-4,9-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),13(17),14-triene-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2C(=O)N3CCCc4cccc(c43)[C@@H]2C1 |
| InChI | InChI=1S/C20H26N2O3/c1-20(2,3)25-19(24)21-11-9-15-16(12-21)14-8-4-6-13-7-5-10-22(17(13)14)18(15)23/h4,6,8,15-16H,5,7,9-12H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | NHRIKDGCFDVVLG-HOTGVXAUSA-N |
| XLogP | 3.32 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |