C17H22N2O2 — CID 169498151
tert-butyl 3-(1H-indol-4-yl)pyrrolidine-1-carboxylate (PubChem CID 169498151) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is tert-butyl 3-(1H-indol-4-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(1H-indol-4-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 169498151 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | tert-butyl 3-(1H-indol-4-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cccc3[nH]ccc23)C1 |
| InChI | InChI=1S/C17H22N2O2/c1-17(2,3)21-16(20)19-10-8-12(11-19)13-5-4-6-15-14(13)7-9-18-15/h4-7,9,12,18H,8,10-11H2,1-3H3 |
| InChIKey | WBKXQIBNHFVFLY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |