C19H27N3O3 — CID 163894718
tert-butyl 3-[7-[amino(hydroxy)methyl]-1H-indol-4-yl]piperidine-1-carboxylate (PubChem CID 163894718) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is tert-butyl 3-[7-[amino(hydroxy)methyl]-1H-indol-4-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[7-[amino(hydroxy)methyl]-1H-indol-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 163894718 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | tert-butyl 3-[7-[amino(hydroxy)methyl]-1H-indol-4-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(c2ccc(C(N)O)c3[nH]ccc23)C1 |
| InChI | InChI=1S/C19H27N3O3/c1-19(2,3)25-18(24)22-10-4-5-12(11-22)13-6-7-15(17(20)23)16-14(13)8-9-21-16/h6-9,12,17,21,23H,4-5,10-11,20H2,1-3H3 |
| InChIKey | QEPYGXXPYDIJSC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|