C19H28N6O2 — CID 178068978
tert-butyl 3-[4-(dimethylaminomethylideneamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]piperidine-1-carboxylate (PubChem CID 178068978) has the molecular formula C19H28N6O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is tert-butyl 3-[4-(dimethylaminomethylideneamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(dimethylaminomethylideneamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 178068978 |
| Molecular Formula | C19H28N6O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | tert-butyl 3-[4-(dimethylaminomethylideneamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]piperidine-1-carboxylate |
| SMILES | CN(C)/C=N\c1ncnc2[nH]cc(C3CCCN(C(=O)OC(C)(C)C)C3)c12 |
| InChI | InChI=1S/C19H28N6O2/c1-19(2,3)27-18(26)25-8-6-7-13(10-25)14-9-20-16-15(14)17(22-11-21-16)23-12-24(4)5/h9,11-13H,6-8,10H2,1-5H3,(H,20,21,22)/b23-12- |
| InChIKey | DFAYABIYLARBDF-FMCGGJTJSA-N |
| XLogP | 3.29 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|