C12H20N4O2 — CID 57080110
tert-butyl 3-(1H-1,2,4-triazol-5-yl)piperidine-1-carboxylate (PubChem CID 57080110) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is tert-butyl 3-(1H-1,2,4-triazol-5-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(1H-1,2,4-triazol-5-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 57080110 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | tert-butyl 3-(1H-1,2,4-triazol-5-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(c2ncn[nH]2)C1 |
| InChI | InChI=1S/C12H20N4O2/c1-12(2,3)18-11(17)16-6-4-5-9(7-16)10-13-8-14-15-10/h8-9H,4-7H2,1-3H3,(H,13,14,15) |
| InChIKey | OUUKMEIIARQFHB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |