C18H25N3O2 — CID 66787018
tert-butyl (3R)-3-(4-methyl-1H-benzimidazol-2-yl)piperidine-1-carboxylate (PubChem CID 66787018) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is tert-butyl (3R)-3-(4-methyl-1H-benzimidazol-2-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(4-methyl-1H-benzimidazol-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66787018 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | tert-butyl (3R)-3-(4-methyl-1H-benzimidazol-2-yl)piperidine-1-carboxylate |
| SMILES | Cc1cccc2[nH]c([C@@H]3CCCN(C(=O)OC(C)(C)C)C3)nc12 |
| InChI | InChI=1S/C18H25N3O2/c1-12-7-5-9-14-15(12)20-16(19-14)13-8-6-10-21(11-13)17(22)23-18(2,3)4/h5,7,9,13H,6,8,10-11H2,1-4H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | BITZPYQTMWIVNF-CYBMUJFWSA-N |
| XLogP | 3.99 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |