C22H22N4O — CID 70713768
1H-indol-2-yl-[3-(4-methyl-1H-benzimidazol-2-yl)piperidin-1-yl]methanone (PubChem CID 70713768) has the molecular formula C22H22N4O and a molecular weight of 358.44 g/mol. Its IUPAC name is 1H-indol-2-yl-[3-(4-methyl-1H-benzimidazol-2-yl)piperidin-1-yl]methanone.
| Compound Name | 1H-indol-2-yl-[3-(4-methyl-1H-benzimidazol-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 70713768 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 1H-indol-2-yl-[3-(4-methyl-1H-benzimidazol-2-yl)piperidin-1-yl]methanone |
| SMILES | Cc1cccc2[nH]c(C3CCCN(C(=O)c4cc5ccccc5[nH]4)C3)nc12 |
| InChI | InChI=1S/C22H22N4O/c1-14-6-4-10-18-20(14)25-21(24-18)16-8-5-11-26(13-16)22(27)19-12-15-7-2-3-9-17(15)23-19/h2-4,6-7,9-10,12,16,23H,5,8,11,13H2,1H3,(H,24,25) |
| InChIKey | QJEYBYIIHKCBAN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |