C22H28N4O — CID 72868287
(1-tert-butylpyrrol-3-yl)-[3-(4-methyl-1H-benzimidazol-2-yl)piperidin-1-yl]methanone (PubChem CID 72868287) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is (1-tert-butylpyrrol-3-yl)-[3-(4-methyl-1H-benzimidazol-2-yl)piperidin-1-yl]methanone.
| Compound Name | (1-tert-butylpyrrol-3-yl)-[3-(4-methyl-1H-benzimidazol-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 72868287 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | (1-tert-butylpyrrol-3-yl)-[3-(4-methyl-1H-benzimidazol-2-yl)piperidin-1-yl]methanone |
| SMILES | Cc1cccc2[nH]c(C3CCCN(C(=O)c4ccn(C(C)(C)C)c4)C3)nc12 |
| InChI | InChI=1S/C22H28N4O/c1-15-7-5-9-18-19(15)24-20(23-18)16-8-6-11-25(13-16)21(27)17-10-12-26(14-17)22(2,3)4/h5,7,9-10,12,14,16H,6,8,11,13H2,1-4H3,(H,23,24) |
| InChIKey | HVDVIKXAFNAXJQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |