C27H30N2O2 — CID 159357421
tert-butyl 4-cyclopropylindole-1-carboxylate;4-cyclopropyl-1H-indole (PubChem CID 159357421) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is tert-butyl 4-cyclopropylindole-1-carboxylate;4-cyclopropyl-1H-indole.
| Compound Name | tert-butyl 4-cyclopropylindole-1-carboxylate;4-cyclopropyl-1H-indole |
|---|---|
| PubChem CID | 159357421 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | tert-butyl 4-cyclopropylindole-1-carboxylate;4-cyclopropyl-1H-indole |
| SMILES | CC(C)(C)OC(=O)n1ccc2c(C3CC3)cccc21.c1cc(C2CC2)c2cc[nH]c2c1 |
| InChI | InChI=1S/C16H19NO2.C11H11N/c1-16(2,3)19-15(18)17-10-9-13-12(11-7-8-11)5-4-6-14(13)17;1-2-9(8-4-5-8)10-6-7-12-11(10)3-1/h4-6,9-11H,7-8H2,1-3H3;1-3,6-8,12H,4-5H2 |
| InChIKey | LICHQIFUPWKVKB-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |