C21H25NO4 — CID 101391363
tert-butyl 4-[(2E)-2-(2-methoxy-2-oxoethylidene)cyclopentyl]indole-1-carboxylate (PubChem CID 101391363) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is tert-butyl 4-[(2E)-2-(2-methoxy-2-oxoethylidene)cyclopentyl]indole-1-carboxylate.
| Compound Name | tert-butyl 4-[(2E)-2-(2-methoxy-2-oxoethylidene)cyclopentyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 101391363 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | tert-butyl 4-[(2E)-2-(2-methoxy-2-oxoethylidene)cyclopentyl]indole-1-carboxylate |
| SMILES | COC(=O)/C=C1\CCCC1c1cccc2c1ccn2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H25NO4/c1-21(2,3)26-20(24)22-12-11-17-16(9-6-10-18(17)22)15-8-5-7-14(15)13-19(23)25-4/h6,9-13,15H,5,7-8H2,1-4H3/b14-13+ |
| InChIKey | NKUGOLWNHFFFBI-BUHFOSPRSA-N |
| XLogP | 4.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|