C23H25ClN2O2 — CID 141367619
tert-butyl 3-[4-(6-chloro-1H-indol-5-yl)phenyl]pyrrolidine-1-carboxylate (PubChem CID 141367619) has the molecular formula C23H25ClN2O2 and a molecular weight of 396.92 g/mol. Its IUPAC name is tert-butyl 3-[4-(6-chloro-1H-indol-5-yl)phenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(6-chloro-1H-indol-5-yl)phenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 141367619 |
| Molecular Formula | C23H25ClN2O2 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | tert-butyl 3-[4-(6-chloro-1H-indol-5-yl)phenyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(-c3cc4cc[nH]c4cc3Cl)cc2)C1 |
| InChI | InChI=1S/C23H25ClN2O2/c1-23(2,3)28-22(27)26-11-9-18(14-26)15-4-6-16(7-5-15)19-12-17-8-10-25-21(17)13-20(19)24/h4-8,10,12-13,18,25H,9,11,14H2,1-3H3 |
| InChIKey | VHMOTIVHNPFQIH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |