C24H26Cl2N2O2 — CID 23541919
tert-butyl (2S,7R)-13-(2,3-dichlorophenyl)-4,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),11(15),12-triene-4-carboxylate (PubChem CID 23541919) has the molecular formula C24H26Cl2N2O2 and a molecular weight of 445.39 g/mol. Its IUPAC name is tert-butyl (2S,7R)-13-(2,3-dichlorophenyl)-4,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),11(15),12-triene-4-carboxylate.
| Compound Name | tert-butyl (2S,7R)-13-(2,3-dichlorophenyl)-4,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),11(15),12-triene-4-carboxylate |
|---|---|
| PubChem CID | 23541919 |
| Molecular Formula | C24H26Cl2N2O2 |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | tert-butyl (2S,7R)-13-(2,3-dichlorophenyl)-4,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),11(15),12-triene-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2[C@H](C1)c1cc(-c3cccc(Cl)c3Cl)cc3c1N2CC3 |
| InChI | InChI=1S/C24H26Cl2N2O2/c1-24(2,3)30-23(29)27-9-8-20-18(13-27)17-12-15(11-14-7-10-28(20)22(14)17)16-5-4-6-19(25)21(16)26/h4-6,11-12,18,20H,7-10,13H2,1-3H3/t18-,20-/m1/s1 |
| InChIKey | URNLMEMXUBSNDJ-UYAOXDASSA-N |
| XLogP | 6.13 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |