C19H25BrN2O2S — CID 86586435
tert-butyl (11S,16R)-3-bromo-7-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene-14-carboxylate (PubChem CID 86586435) has the molecular formula C19H25BrN2O2S and a molecular weight of 425.39 g/mol. Its IUPAC name is tert-butyl (11S,16R)-3-bromo-7-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene-14-carboxylate.
| Compound Name | tert-butyl (11S,16R)-3-bromo-7-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene-14-carboxylate |
|---|---|
| PubChem CID | 86586435 |
| Molecular Formula | C19H25BrN2O2S |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | tert-butyl (11S,16R)-3-bromo-7-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene-14-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2[C@@H](C1)c1cc(Br)cc3c1N2CCSC3 |
| InChI | InChI=1S/C19H25BrN2O2S/c1-19(2,3)24-18(23)21-5-4-16-15(10-21)14-9-13(20)8-12-11-25-7-6-22(16)17(12)14/h8-9,15-16H,4-7,10-11H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | ZDNKUTZGZHHSNR-HOTGVXAUSA-N |
| XLogP | 4.61 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |