C25H28Cl2N2O2 — CID 23541944
tert-butyl (10R,15S)-7-(2,5-dichlorophenyl)-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene-12-carboxylate (PubChem CID 23541944) has the molecular formula C25H28Cl2N2O2 and a molecular weight of 459.42 g/mol. Its IUPAC name is tert-butyl (10R,15S)-7-(2,5-dichlorophenyl)-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene-12-carboxylate.
| Compound Name | tert-butyl (10R,15S)-7-(2,5-dichlorophenyl)-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene-12-carboxylate |
|---|---|
| PubChem CID | 23541944 |
| Molecular Formula | C25H28Cl2N2O2 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | tert-butyl (10R,15S)-7-(2,5-dichlorophenyl)-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene-12-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2[C@@H](C1)c1cc(-c3cc(Cl)ccc3Cl)cc3c1N2CCC3 |
| InChI | InChI=1S/C25H28Cl2N2O2/c1-25(2,3)31-24(30)28-10-8-22-20(14-28)19-12-16(18-13-17(26)6-7-21(18)27)11-15-5-4-9-29(22)23(15)19/h6-7,11-13,20,22H,4-5,8-10,14H2,1-3H3/t20-,22-/m0/s1 |
| InChIKey | NRULPYCKJHWVMX-UNMCSNQZSA-N |
| XLogP | 6.52 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |