C27H30ClF3N2O2 — CID 23541973
tert-butyl (11S,16R)-3-[2-chloro-4-(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene-14-carboxylate (PubChem CID 23541973) has the molecular formula C27H30ClF3N2O2 and a molecular weight of 507.00 g/mol. Its IUPAC name is tert-butyl (11S,16R)-3-[2-chloro-4-(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene-14-carboxylate.
| Compound Name | tert-butyl (11S,16R)-3-[2-chloro-4-(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene-14-carboxylate |
|---|---|
| PubChem CID | 23541973 |
| Molecular Formula | C27H30ClF3N2O2 |
| Molecular Weight | 507.00 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | tert-butyl (11S,16R)-3-[2-chloro-4-(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene-14-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2[C@@H](C1)c1cc(-c3ccc(C(F)(F)F)cc3Cl)cc3c1N2CCCC3 |
| InChI | InChI=1S/C27H30ClF3N2O2/c1-26(2,3)35-25(34)32-11-9-23-21(15-32)20-13-17(12-16-6-4-5-10-33(23)24(16)20)19-8-7-18(14-22(19)28)27(29,30)31/h7-8,12-14,21,23H,4-6,9-11,15H2,1-3H3/t21-,23-/m0/s1 |
| InChIKey | XUPGQLBJZOUFQL-GMAHTHKFSA-N |
| XLogP | 7.28 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.00 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |