C23H22F6N2 — CID 22021760
3-[2,4-bis(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene (PubChem CID 22021760) has the molecular formula C23H22F6N2 and a molecular weight of 440.43 g/mol. Its IUPAC name is 3-[2,4-bis(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene.
| Compound Name | 3-[2,4-bis(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene |
|---|---|
| PubChem CID | 22021760 |
| Molecular Formula | C23H22F6N2 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 3-[2,4-bis(trifluoromethyl)phenyl]-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene |
| SMILES | FC(F)(F)c1ccc(-c2cc3c4c(c2)C2CNCCC2N4CCCC3)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H22F6N2/c24-22(25,26)15-4-5-16(19(11-15)23(27,28)29)14-9-13-3-1-2-8-31-20-6-7-30-12-18(20)17(10-14)21(13)31/h4-5,9-11,18,20,30H,1-3,6-8,12H2 |
| InChIKey | SJSVERUXKQAPHX-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |