C22H26N2OS — CID 59922320
(11S,16R)-3-(2,4-dimethylphenyl)-7λ4-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene 7-oxide (PubChem CID 59922320) has the molecular formula C22H26N2OS and a molecular weight of 366.53 g/mol. Its IUPAC name is (11S,16R)-3-(2,4-dimethylphenyl)-7λ4-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene 7-oxide.
| Compound Name | (11S,16R)-3-(2,4-dimethylphenyl)-7λ4-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene 7-oxide |
|---|---|
| PubChem CID | 59922320 |
| Molecular Formula | C22H26N2OS |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (11S,16R)-3-(2,4-dimethylphenyl)-7λ4-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene 7-oxide |
| SMILES | Cc1ccc(-c2cc3c4c(c2)[C@@H]2CNCC[C@@H]2N4CCS(=O)C3)c(C)c1 |
| InChI | InChI=1S/C22H26N2OS/c1-14-3-4-18(15(2)9-14)16-10-17-13-26(25)8-7-24-21-5-6-23-12-20(21)19(11-16)22(17)24/h3-4,9-11,20-21,23H,5-8,12-13H2,1-2H3/t20-,21-,26?/m0/s1 |
| InChIKey | XMIQZUORTUJMQL-IPEYFGQDSA-N |
| XLogP | 3.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |