C22H23F3N2O — CID 10221866
(10S,15R)-7-[4-methoxy-2-(trifluoromethyl)phenyl]-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene (PubChem CID 10221866) has the molecular formula C22H23F3N2O and a molecular weight of 388.43 g/mol. Its IUPAC name is (10S,15R)-7-[4-methoxy-2-(trifluoromethyl)phenyl]-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene.
| Compound Name | (10S,15R)-7-[4-methoxy-2-(trifluoromethyl)phenyl]-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene |
|---|---|
| PubChem CID | 10221866 |
| Molecular Formula | C22H23F3N2O |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (10S,15R)-7-[4-methoxy-2-(trifluoromethyl)phenyl]-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene |
| SMILES | COc1ccc(-c2cc3c4c(c2)[C@H]2CNCC[C@H]2N4CCC3)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H23F3N2O/c1-28-15-4-5-16(19(11-15)22(23,24)25)14-9-13-3-2-8-27-20-6-7-26-12-18(20)17(10-14)21(13)27/h4-5,9-11,18,20,26H,2-3,6-8,12H2,1H3/t18-,20-/m1/s1 |
| InChIKey | YLYUXVJVGYRALA-UYAOXDASSA-N |
| XLogP | 4.59 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |