C20H20Cl2N2 — CID 10269804
(10S,15R)-7-(3,5-dichlorophenyl)-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene (PubChem CID 10269804) has the molecular formula C20H20Cl2N2 and a molecular weight of 359.30 g/mol. Its IUPAC name is (10S,15R)-7-(3,5-dichlorophenyl)-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene.
| Compound Name | (10S,15R)-7-(3,5-dichlorophenyl)-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene |
|---|---|
| PubChem CID | 10269804 |
| Molecular Formula | C20H20Cl2N2 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | (10S,15R)-7-(3,5-dichlorophenyl)-1,12-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-triene |
| SMILES | Clc1cc(Cl)cc(-c2cc3c4c(c2)[C@H]2CNCC[C@H]2N4CCC3)c1 |
| InChI | InChI=1S/C20H20Cl2N2/c21-15-7-14(8-16(22)10-15)13-6-12-2-1-5-24-19-3-4-23-11-18(19)17(9-13)20(12)24/h6-10,18-19,23H,1-5,11H2/t18-,19-/m1/s1 |
| InChIKey | WHBCTWOILSDQJG-RTBURBONSA-N |
| XLogP | 4.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |