C14H19N3 — CID 137458700
(11R,16S)-7,10,14-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene (PubChem CID 137458700) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is (11R,16S)-7,10,14-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene.
| Compound Name | (11R,16S)-7,10,14-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene |
|---|---|
| PubChem CID | 137458700 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | (11R,16S)-7,10,14-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene |
| SMILES | c1cc2c3c(c1)[C@H]1CNCC[C@H]1N3CCNC2 |
| InChI | InChI=1S/C14H19N3/c1-2-10-8-16-6-7-17-13-4-5-15-9-12(13)11(3-1)14(10)17/h1-3,12-13,15-16H,4-9H2/t12-,13-/m1/s1 |
| InChIKey | PCAGRVCLPXFTJC-CHWSQXEVSA-N |
| XLogP | 1.06 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |