C15H21N3 — CID 21302497
(10R,15S)-4-ethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene (PubChem CID 21302497) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is (10R,15S)-4-ethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene.
| Compound Name | (10R,15S)-4-ethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
|---|---|
| PubChem CID | 21302497 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | (10R,15S)-4-ethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
| SMILES | CCN1CCN2c3c(cccc31)[C@@H]1CNCC[C@@H]12 |
| InChI | InChI=1S/C15H21N3/c1-2-17-8-9-18-13-6-7-16-10-12(13)11-4-3-5-14(17)15(11)18/h3-5,12-13,16H,2,6-10H2,1H3/t12-,13-/m0/s1 |
| InChIKey | VZFZQNJKDXPQJK-STQMWFEESA-N |
| XLogP | 1.79 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |