C13H16N2O — CID 146675585
1-(1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-5-yl)ethanone (PubChem CID 146675585) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-5-yl)ethanone.
| Compound Name | 1-(1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-5-yl)ethanone |
|---|---|
| PubChem CID | 146675585 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1-(1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-5-yl)ethanone |
| SMILES | CC(=O)N1c2ccccc2C2CNCCC21 |
| InChI | InChI=1S/C13H16N2O/c1-9(16)15-12-5-3-2-4-10(12)11-8-14-7-6-13(11)15/h2-5,11,13-14H,6-8H2,1H3 |
| InChIKey | VCHMFUOHDGZSMX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |