C12H15N3O — CID 125219355
(4aS,9bR)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole-5-carboxamide (PubChem CID 125219355) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is (4aS,9bR)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole-5-carboxamide.
| Compound Name | (4aS,9bR)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole-5-carboxamide |
|---|---|
| PubChem CID | 125219355 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | (4aS,9bR)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole-5-carboxamide |
| SMILES | NC(=O)N1c2ccccc2[C@@H]2CNCC[C@@H]21 |
| InChI | InChI=1S/C12H15N3O/c13-12(16)15-10-4-2-1-3-8(10)9-7-14-6-5-11(9)15/h1-4,9,11,14H,5-7H2,(H2,13,16)/t9-,11-/m0/s1 |
| InChIKey | PTJIWQVEMSZYEC-ONGXEEELSA-N |
| XLogP | 1.03 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |