About methyl 1a,6b-dihydro-1H-cyclopropa[b]indole-2-carboxylate
methyl 1a,6b-dihydro-1H-cyclopropa[b]indole-2-carboxylate (PubChem CID 582671) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is methyl 1a,6b-dihydro-1H-cyclopropa[b]indole-2-carboxylate.
Analyze methyl 1a,6b-dihydro-1H-cyclopropa[b]indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1a,6b-dihydro-1H-cyclopropa[b]indole-2-carboxylate?
The IUPAC name of methyl 1a,6b-dihydro-1H-cyclopropa[b]indole-2-carboxylate (CID 582671) is methyl 1a,6b-dihydro-1H-cyclopropa[b]indole-2-carboxylate.
What is the SMILES notation for methyl 1a,6b-dihydro-1H-cyclopropa[b]indole-2-carboxylate?
The canonical SMILES for methyl 1a,6b-dihydro-1H-cyclopropa[b]indole-2-carboxylate is COC(=O)N1c2ccccc2C2CC21.
What is the InChIKey of methyl 1a,6b-dihydro-1H-cyclopropa[b]indole-2-carboxylate?
The InChIKey is SYBTWSRLILYBIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c1-14-11(13)12-9-5-3-2-4-7(9)8-6-10(8)12/h2-5,8,10H,6H2,1H3.
What are the key properties of methyl 1a,6b-dihydro-1H-cyclopropa[b]indole-2-carboxylate?
methyl 1a,6b-dihydro-1H-cyclopropa[b]indole-2-carboxylate has a molecular weight of 189.21 g/mol, XLogP of 2.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1a,6b-dihydro-1H-cyclopropa[b]indole-2-carboxylate is sourced from PubChem (CID 582671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).